Products 147076-36-6
CAS 147076-36-6 appears in our catalog under these names: Laflunimus, Laflunimus, 99.70%, Laflunimus (Standard). Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 5 mg, 50 mg, 100 mg, 10 mg.
(Z)-2-cyano-3-cyclopropyl-3-hydroxy-N-[3-methyl-4-(trifluoromethyl)phenyl]prop-2-enamide (CAS 147076-36-6) is a chemical compound with the molecular formula C15H13F3N2O2 and a molecular weight of 310.27 g/mol. IUPAC name: (Z)-2-cyano-3-cyclopropyl-3-hydroxy-N-[3-methyl-4-(trifluoromethyl)phenyl]prop-2-enamide. InChIKey: GDHFOVCRYCPOTK-QBFSEMIESA-N.
| Molecular formula | C15H13F3N2O2 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | (Z)-2-cyano-3-cyclopropyl-3-hydroxy-N-[3-methyl-4-(trifluoromethyl)phenyl]prop-2-enamide |
| InChIKey | GDHFOVCRYCPOTK-QBFSEMIESA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)/C(=C(/C2CC2)\O)/C#N)C(F)(F)F |
Computed by PubChem (NCBI)