CAS 14712-32-4 appears in our catalog under these names: [2,2′-Bipyridin]-4-ol, 97%, 97%, 1,4-dihydro-[2,2'-bipyridin]-4-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-pyridin-2-yl-1H-pyridin-4-one (CAS 14712-32-4) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 2-pyridin-2-yl-1H-pyridin-4-one. InChIKey: PIQHJUNSCZAHAS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 2-pyridin-2-yl-1H-pyridin-4-one |
| InChIKey | PIQHJUNSCZAHAS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=O)C=CN2 |
Computed by PubChem (NCBI)