CAS 1471339-65-7 appears in our catalog under these names: 2–(4–(1,2,2–triphenylvinyl)phenoxy)acetic acid, 2-(4-(1,2,2-triphenylvinyl)phenoxy)acetic acid 98% mix TBC as stabilizer, 2-(4-(1,2,2-triphenylvinyl)phenoxy)acetic acid, 98%, 98%, 2-(4-(1,2,2-triphenylvinyl)phenoxy)acetic acid, 98%(stabilized with TBC). Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-[4-(1,2,2-triphenylethenyl)phenoxy]acetic acid (CAS 1471339-65-7) is a chemical compound with the molecular formula C28H22O3 and a molecular weight of 406.5 g/mol. IUPAC name: 2-[4-(1,2,2-triphenylethenyl)phenoxy]acetic acid. InChIKey: GOFIMUDMXZWRPY-UHFFFAOYSA-N.
| Molecular formula | C28H22O3 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 2-[4-(1,2,2-triphenylethenyl)phenoxy]acetic acid |
| InChIKey | GOFIMUDMXZWRPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)OCC(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)