Products 1760-46-9
CAS 1760-46-9 appears in our catalog under these names: Diphenylacetic anhydride, 95%, Diphenylacetic Anhydride, Diphenylacetic Anhydride, Diphenylacetic Anhydride, >95.0%(T). Offered by: Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 1g, 2g, 10g.
(2,2-diphenylacetyl) 2,2-diphenylacetate (CAS 1760-46-9) is a chemical compound with the molecular formula C28H22O3 and a molecular weight of 406.5 g/mol. IUPAC name: (2,2-diphenylacetyl) 2,2-diphenylacetate. InChIKey: YZMRCMTTYLBDPD-UHFFFAOYSA-N.
| Molecular formula | C28H22O3 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | (2,2-diphenylacetyl) 2,2-diphenylacetate |
| InChIKey | YZMRCMTTYLBDPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)OC(=O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Diphenylacetic acid anhydride, Acetic acid, diphenyl-, anhydride, Benzeneacetic acid, .alpha.-phenyl-, anhydride, Benzeneacetic acid, alpha-phenyl-, anhydride, DIPHENYLACETIC ACID ACID ANHYDRIDE [MI], DIPHENYLACETIC ACID ACID ANHYDRIDE, (2,2-diphenylacetyl) 2,2-diphenylacetate, Benzeneacetic acid, alpha-phenyl-, 1,1'-anhydride, 2,2-Diphenylacetic anhydride, Benzeneacetic acid, anhydride