Products 1472756-01-6
CAS 1472756-01-6 is the registry number for Ethyl 2-(3-chloro-4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-chloro-4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (CAS 1472756-01-6) is a chemical compound with the molecular formula C13H12ClFN2O2 and a molecular weight of 282.70 g/mol. IUPAC name: ethyl 2-(3-chloro-4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate. InChIKey: DCTAIDRPLUNCLB-UHFFFAOYSA-N.
| Molecular formula | C13H12ClFN2O2 |
|---|---|
| Molecular weight | 282.70 g/mol |
| IUPAC name | ethyl 2-(3-chloro-4-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| InChIKey | DCTAIDRPLUNCLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=N1)C2=CC(=C(C=C2)F)Cl)C |
Computed by PubChem (NCBI)