Products 91167-75-8
CAS 91167-75-8 is the registry number for 2-(4-Chloro-2-fluoro-5-hydroxyphenyl)-2,3a,4,5,6,7-hexahydro-3H-indazol-3-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydro-3aH-indazol-3-one (CAS 91167-75-8) is a chemical compound with the molecular formula C13H12ClFN2O2 and a molecular weight of 282.70 g/mol. IUPAC name: 2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydro-3aH-indazol-3-one. InChIKey: UIFXFQUSLWBNJY-UHFFFAOYSA-N.
| Molecular formula | C13H12ClFN2O2 |
|---|---|
| Molecular weight | 282.70 g/mol |
| IUPAC name | 2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydro-3aH-indazol-3-one |
| InChIKey | UIFXFQUSLWBNJY-UHFFFAOYSA-N |
| SMILES | C1CCC2=NN(C(=O)C2C1)C3=CC(=C(C=C3F)Cl)O |
Computed by PubChem (NCBI)