CAS 147539-29-5 appears in our catalog under these names: 1-(3-Nitro-pyridin-2-yl)-[1,4]diazepane, 95%, 1-(3-Nitropyridin-2-yl)-1,4-diazepane, 95%, 1-(3-Nitro-pyridin-2-yl)-[1,4]diazepane, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-nitro-2-pyridinyl)-1,4-diazepane (CAS 147539-29-5) is a chemical compound with the molecular formula C10H14N4O2 and a molecular weight of 222.24 g/mol. IUPAC name: 1-(3-nitro-2-pyridinyl)-1,4-diazepane. InChIKey: VBFOCWZEZQRKLP-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-(3-nitro-2-pyridinyl)-1,4-diazepane |
| InChIKey | VBFOCWZEZQRKLP-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)