CAS 287114-27-6 appears in our catalog under these names: 1-(5-Nitropyridin-2-yl)homopiperazine, 95%, 1-(5-Nitropyridin-2-yl)-1,4-diazepane, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1-(5-nitro-2-pyridinyl)-1,4-diazepane (CAS 287114-27-6) is a chemical compound with the molecular formula C10H14N4O2 and a molecular weight of 222.24 g/mol. IUPAC name: 1-(5-nitro-2-pyridinyl)-1,4-diazepane. InChIKey: HVIKXFXKZFWDTQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-(5-nitro-2-pyridinyl)-1,4-diazepane |
| InChIKey | HVIKXFXKZFWDTQ-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)