CAS 1476748-74-9 appears in our catalog under these names: (R)-2-Amino-3,3-dimethylbutanamide hydrochloride, 95%, (2R)-2-Amino-3,3-dimethylbutanamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
(2R)-2-amino-3,3-dimethylbutanamide;hydrochloride (CAS 1476748-74-9) is a chemical compound with the molecular formula C6H15ClN2O and a molecular weight of 166.65 g/mol. IUPAC name: (2R)-2-amino-3,3-dimethylbutanamide;hydrochloride. InChIKey: ZTHDYUDIZSIFRY-WCCKRBBISA-N.
| Molecular formula | C6H15ClN2O |
|---|---|
| Molecular weight | 166.65 g/mol |
| IUPAC name | (2R)-2-amino-3,3-dimethylbutanamide;hydrochloride |
| InChIKey | ZTHDYUDIZSIFRY-WCCKRBBISA-N |
| SMILES | CC(C)(C)[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)