CAS 75158-12-2 appears in our catalog under these names: (S)-2-Amino-3,3-dimethylbutanamide Hydrochloride, (S)-2-Amino-3,3-dimethylbutanamide hydrochloride, 98%, (S)-2-Amino-3,3-dimethylbutanamide hydrochloride, 98%, 98%, L–tert–leucinaMide hydrochloride. Offered by: TRC, Fluorochem, Chemat, GLPBio. Available pack sizes: 100mg, 1g, 5g, 25g, 100g, 200mg.
(2S)-2-amino-3,3-dimethylbutanamide;hydrochloride (CAS 75158-12-2) is a chemical compound with the molecular formula C6H15ClN2O and a molecular weight of 166.65 g/mol. IUPAC name: (2S)-2-amino-3,3-dimethylbutanamide;hydrochloride. InChIKey: ZTHDYUDIZSIFRY-PGMHMLKASA-N.
| Molecular formula | C6H15ClN2O |
|---|---|
| Molecular weight | 166.65 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dimethylbutanamide;hydrochloride |
| InChIKey | ZTHDYUDIZSIFRY-PGMHMLKASA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)