CAS 147682-51-7 appears in our catalog under these names: 4-Hydroxy-3-nitrobenzenesulfonyl chloride, 95%, 4-Hydroxy-3-nitrobenzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 2,5g.
4-hydroxy-3-nitrobenzenesulfonyl chloride (CAS 147682-51-7) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzenesulfonyl chloride. InChIKey: FRIDVSSBTNZNJD-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO5S |
|---|---|
| Molecular weight | 237.62 g/mol |
| IUPAC name | 4-hydroxy-3-nitrobenzenesulfonyl chloride |
| InChIKey | FRIDVSSBTNZNJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)