Products 147682-51-7

CAS 147682-51-7 appears in our catalog under these names: 4-Hydroxy-3-nitrobenzenesulfonyl chloride, 95%, 4-Hydroxy-3-nitrobenzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 2,5g.

Structural formula: {0} (CAS {1})

4-hydroxy-3-nitrobenzenesulfonyl chloride (CAS 147682-51-7) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzenesulfonyl chloride. InChIKey: FRIDVSSBTNZNJD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClNO5S
Molecular weight237.62 g/mol
IUPAC name4-hydroxy-3-nitrobenzenesulfonyl chloride
InChIKeyFRIDVSSBTNZNJD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])O

Computed by PubChem (NCBI)