Products 121-18-6
CAS 121-18-6 appears in our catalog under these names: 4-Chloro-3-nitrobenzenesulfonic acid, 95%, 4–Chloro–3–nitrobenzenesulfonic acid, Benzenesulfonic acid,4-chloro-3-nitro-, 97%, 97%, 4-Chloro-3-nitrobenzenesulfonic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 100mg, 10g, 100g.
4-chloro-3-nitrobenzenesulfonic acid (CAS 121-18-6) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 4-chloro-3-nitrobenzenesulfonic acid. InChIKey: RPKWNMFDAOACCX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO5S |
|---|---|
| Molecular weight | 237.62 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenesulfonic acid |
| InChIKey | RPKWNMFDAOACCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-3-nitrobenzenesulfonic acid, Benzenesulfonic acid, 4-chloro-3-nitro-, o-Nitrochlorobenzene-p-sulfonic acid, 2-Nitrochlorobenzene-4-sulfonic acid, Benzenesulfonic acid,4-chloro-3-nitro-, 4-chloro-3-nitro-benzenesulfonic acid, 4-chloro-3-nitrobenzene-1-sulfonic acid, 3-Nitro-4-chlorobenzenesulfonic acid, 4-Chloro-3-nitrobenzenesulphonic acid, 2-Nitrochlorbenzol-4-sulfosaure