CAS 147702-14-5 appears in our catalog under these names: (S)-VANOL, 97%, (2S)-3,3'-Diphenyl[2,2'-binaphthalene]-1,1'-diol, 97%, (S)-VANOL, 98% 99%ee. Offered by: Sigma-Aldrich, Fluorochem, Ambeed. Available pack sizes: 250MG, 100mg, 1g, 5g.
2-(1-hydroxy-3-phenylnaphthalen-2-yl)-3-phenylnaphthalen-1-ol (CAS 147702-14-5) is a chemical compound with the molecular formula C32H22O2 and a molecular weight of 438.5 g/mol. IUPAC name: 2-(1-hydroxy-3-phenylnaphthalen-2-yl)-3-phenylnaphthalen-1-ol. InChIKey: NDTDVKKGYBULHF-UHFFFAOYSA-N.
| Molecular formula | C32H22O2 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-(1-hydroxy-3-phenylnaphthalen-2-yl)-3-phenylnaphthalen-1-ol |
| InChIKey | NDTDVKKGYBULHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2C4=C(C5=CC=CC=C5C=C4C6=CC=CC=C6)O)O |
Computed by PubChem (NCBI)