CAS 75684-93-4 appears in our catalog under these names: (R)–3,3’–Bis(phenyl)–1,1’–bi–2–naphthol, (R)-3,3'-Diphenyl-[1,1'-binaphthalene]-2,2'-diol 97% 99%ee, R-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol, 98%, 98%, (R)-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol (CAS 75684-93-4) is a chemical compound with the molecular formula C32H22O2 and a molecular weight of 438.5 g/mol. IUPAC name: 1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol. InChIKey: UXSXQZYUHXUTTI-UHFFFAOYSA-N.
| Molecular formula | C32H22O2 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol |
| InChIKey | UXSXQZYUHXUTTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)O |
Computed by PubChem (NCBI)