CAS 147730-41-4 is the registry number for (2S)-1,1,1-Trifluoro-3-(phenylsulfanyl)-2-propanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-1,1,1-trifluoro-3-phenylsulfanylpropan-2-ol (CAS 147730-41-4) is a chemical compound with the molecular formula C9H9F3OS and a molecular weight of 222.23 g/mol. IUPAC name: (2S)-1,1,1-trifluoro-3-phenylsulfanylpropan-2-ol. InChIKey: XCPXRBHWUYVMRH-MRVPVSSYSA-N.
| Molecular formula | C9H9F3OS |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | (2S)-1,1,1-trifluoro-3-phenylsulfanylpropan-2-ol |
| InChIKey | XCPXRBHWUYVMRH-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)SC[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)