CAS 21101-66-6 appears in our catalog under these names: 1-{4-((trifluoromethyl)sulfanyl)phenyl}ethan-1-ol, 95%, 1-{4-((Trifluoromethyl)sulfanyl)phenyl}ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[4-(trifluoromethylsulfanyl)phenyl]ethanol (CAS 21101-66-6) is a chemical compound with the molecular formula C9H9F3OS and a molecular weight of 222.23 g/mol. IUPAC name: 1-[4-(trifluoromethylsulfanyl)phenyl]ethanol. InChIKey: HSJRMALTSZKPOV-UHFFFAOYSA-N.
| Molecular formula | C9H9F3OS |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 1-[4-(trifluoromethylsulfanyl)phenyl]ethanol |
| InChIKey | HSJRMALTSZKPOV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)SC(F)(F)F)O |
Computed by PubChem (NCBI)