CAS 1477712-69-8 appears in our catalog under these names: 4-Fluoro-3,5-dimethylbenzene-1-sulfonamide, 95%, 4-Fluoro-3,5-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 250mg, 1g.
4-fluoro-3,5-dimethylbenzenesulfonamide (CAS 1477712-69-8) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 4-fluoro-3,5-dimethylbenzenesulfonamide. InChIKey: YVWYPSXQDCDDIK-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO2S |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-fluoro-3,5-dimethylbenzenesulfonamide |
| InChIKey | YVWYPSXQDCDDIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)S(=O)(=O)N |
Computed by PubChem (NCBI)