CAS 147780-38-9 is the registry number for ((1R,3S)-3-Aminocyclopentyl)methanol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(1R,3S)-3-aminocyclopentyl]methanol;hydrochloride (CAS 147780-38-9) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: [(1R,3S)-3-aminocyclopentyl]methanol;hydrochloride. InChIKey: QXSRCFAPVVTLBT-IBTYICNHSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | [(1R,3S)-3-aminocyclopentyl]methanol;hydrochloride |
| InChIKey | QXSRCFAPVVTLBT-IBTYICNHSA-N |
| SMILES | C1C[C@@H](C[C@@H]1CO)N.Cl |
Computed by PubChem (NCBI)