CAS 147780-60-7 is the registry number for (R)-Methyl 2-(benzyloxycarbonylamino)-2-phenylacetate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetate (CAS 147780-60-7) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: methyl (2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetate. InChIKey: XLCNUVWZZAARLI-OAHLLOKOSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | methyl (2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| InChIKey | XLCNUVWZZAARLI-OAHLLOKOSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)