Products 77234-00-5

CAS 77234-00-5 appears in our catalog under these names: Dimethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate, 95%, Dimethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate (CAS 77234-00-5) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate. InChIKey: ZRODZECCHZZHBO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17NO4
Molecular weight299.32 g/mol
IUPAC namedimethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate
InChIKeyZRODZECCHZZHBO-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)