CAS 147835-68-5 is the registry number for 2,2'-Bis(trifluoromethoxy)-[1,1'-biphenyl]-4,4'-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-amino-2-(trifluoromethoxy)phenyl]-3-(trifluoromethoxy)aniline (CAS 147835-68-5) is a chemical compound with the molecular formula C14H10F6N2O2 and a molecular weight of 352.23 g/mol. IUPAC name: 4-[4-amino-2-(trifluoromethoxy)phenyl]-3-(trifluoromethoxy)aniline. InChIKey: NZOHUOCKJIYPKT-UHFFFAOYSA-N.
| Molecular formula | C14H10F6N2O2 |
|---|---|
| Molecular weight | 352.23 g/mol |
| IUPAC name | 4-[4-amino-2-(trifluoromethoxy)phenyl]-3-(trifluoromethoxy)aniline |
| InChIKey | NZOHUOCKJIYPKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)OC(F)(F)F)C2=C(C=C(C=C2)N)OC(F)(F)F |
Computed by PubChem (NCBI)