CAS 1911650-53-7 is the registry number for STG-001. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]propanoic acid (CAS 1911650-53-7) is a chemical compound with the molecular formula C14H10F6N2O2 and a molecular weight of 352.23 g/mol. IUPAC name: 3-[3-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]propanoic acid. InChIKey: WSFKMLQSYRCAQE-UHFFFAOYSA-N.
| Molecular formula | C14H10F6N2O2 |
|---|---|
| Molecular weight | 352.23 g/mol |
| IUPAC name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]propanoic acid |
| InChIKey | WSFKMLQSYRCAQE-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)