CAS 1478359-68-0 is the registry number for 1-Chloro-4-cyclopropylphthalazine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-chloro-4-cyclopropylphthalazine (CAS 1478359-68-0) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 1-chloro-4-cyclopropylphthalazine. InChIKey: HAGRNXPVMBSKTK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 1-chloro-4-cyclopropylphthalazine |
| InChIKey | HAGRNXPVMBSKTK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C(C3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)