Products 1478463-68-1

CAS 1478463-68-1 is the registry number for 3-(3-Chloro-4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-chloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1478463-68-1) is a chemical compound with the molecular formula C12H10ClNO4 and a molecular weight of 267.66 g/mol. IUPAC name: 3-(3-chloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: AGQBXSJGVFQJQX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO4
Molecular weight267.66 g/mol
IUPAC name3-(3-chloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyAGQBXSJGVFQJQX-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC(=C(C=C2)OC)Cl)C(=O)O

Computed by PubChem (NCBI)