Products 905810-50-6

CAS 905810-50-6 is the registry number for 4-[(2-Chlorophenoxy)methyl]-5-methylisoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid (CAS 905810-50-6) is a chemical compound with the molecular formula C12H10ClNO4 and a molecular weight of 267.66 g/mol. IUPAC name: 4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: RGXQIXVPWCUTJK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO4
Molecular weight267.66 g/mol
IUPAC name4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid
InChIKeyRGXQIXVPWCUTJK-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C(=O)O)COC2=CC=CC=C2Cl

Computed by PubChem (NCBI)