CAS 905810-50-6 is the registry number for 4-[(2-Chlorophenoxy)methyl]-5-methylisoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid (CAS 905810-50-6) is a chemical compound with the molecular formula C12H10ClNO4 and a molecular weight of 267.66 g/mol. IUPAC name: 4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: RGXQIXVPWCUTJK-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO4 |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | 4-[(2-chlorophenoxy)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | RGXQIXVPWCUTJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)COC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)