Products 1479164-98-1
CAS 1479164-98-1 is the registry number for N-tert-Butyl-4-methylbenzo(d)oxazol-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
N-tert-butyl-4-methyl-1,3-benzoxazol-2-amine (CAS 1479164-98-1) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: N-tert-butyl-4-methyl-1,3-benzoxazol-2-amine. InChIKey: KVUBUGDUOMSEIG-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | N-tert-butyl-4-methyl-1,3-benzoxazol-2-amine |
| InChIKey | KVUBUGDUOMSEIG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC(=N2)NC(C)(C)C |
Computed by PubChem (NCBI)