CAS 14804-41-2 is the registry number for 5-bromo-1,3-diisopropyl-2-methoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-methoxy-1,3-di(propan-2-yl)benzene (CAS 14804-41-2) is a chemical compound with the molecular formula C13H19BrO and a molecular weight of 271.19 g/mol. IUPAC name: 5-bromo-2-methoxy-1,3-di(propan-2-yl)benzene. InChIKey: PPBFJCWDVJEYCW-UHFFFAOYSA-N.
| Molecular formula | C13H19BrO |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 5-bromo-2-methoxy-1,3-di(propan-2-yl)benzene |
| InChIKey | PPBFJCWDVJEYCW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1OC)C(C)C)Br |
Computed by PubChem (NCBI)