CAS 93982-04-8 is the registry number for Oxymetazoline Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
3-(bromomethyl)-6-tert-butyl-2,4-dimethylphenol (CAS 93982-04-8) is a chemical compound with the molecular formula C13H19BrO and a molecular weight of 271.19 g/mol. IUPAC name: 3-(bromomethyl)-6-tert-butyl-2,4-dimethylphenol. InChIKey: FWQNVJNDLOHEOS-UHFFFAOYSA-N.
| Molecular formula | C13H19BrO |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 3-(bromomethyl)-6-tert-butyl-2,4-dimethylphenol |
| InChIKey | FWQNVJNDLOHEOS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CBr)C)O)C(C)(C)C |
Computed by PubChem (NCBI)