Products 1480524-41-1
CAS 1480524-41-1 is the registry number for 3-Chloro-n-cyclohexyl-5-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-cyclohexyl-5-nitrobenzamide (CAS 1480524-41-1) is a chemical compound with the molecular formula C13H15ClN2O3 and a molecular weight of 282.72 g/mol. IUPAC name: 3-chloro-N-cyclohexyl-5-nitrobenzamide. InChIKey: AXBUNDIFMREYRB-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O3 |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | 3-chloro-N-cyclohexyl-5-nitrobenzamide |
| InChIKey | AXBUNDIFMREYRB-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)