CAS 2140327-04-2 is the registry number for H-Beta-ala-amc hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride (CAS 2140327-04-2) is a chemical compound with the molecular formula C13H15ClN2O3 and a molecular weight of 282.72 g/mol. IUPAC name: 3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride. InChIKey: DIJJRNDYZBYWBN-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O3 |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | 3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride |
| InChIKey | DIJJRNDYZBYWBN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)CCN.Cl |
Computed by PubChem (NCBI)