CAS 1226898-92-5 appears in our catalog under these names: 2-Chloro-7,8-dihydro-5-oxo-1,6-naphthyridine-6(5h)-carboxylic acid 1,1-dimethylethyl ester, 95%, tert-butyl 2-chloro-5-oxo-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 98%, 98%, 2-CHLORO-7,8-DIHYDRO-5-OXO-1,6-NAPHTHYRIDINE-6(5H)-CARBOXYLIC ACID 1,1-DIMETHYLETHYL ESTER, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
Tert-butyl 2-chloro-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate (CAS 1226898-92-5) is a chemical compound with the molecular formula C13H15ClN2O3 and a molecular weight of 282.72 g/mol. IUPAC name: tert-butyl 2-chloro-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate. InChIKey: NZUPOTKGOUDRKP-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O3 |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | tert-butyl 2-chloro-5-oxo-7,8-dihydro-1,6-naphthyridine-6-carboxylate |
| InChIKey | NZUPOTKGOUDRKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1=O)C=CC(=N2)Cl |
Computed by PubChem (NCBI)