CAS 14816-67-2 is the registry number for rac-Soterenol Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
N-[2-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide;hydrochloride (CAS 14816-67-2) is a chemical compound with the molecular formula C12H21ClN2O4S and a molecular weight of 324.82 g/mol. IUPAC name: N-[2-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide;hydrochloride. InChIKey: LTQWQTNRIBKUMN-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O4S |
|---|---|
| Molecular weight | 324.82 g/mol |
| IUPAC name | N-[2-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide;hydrochloride |
| InChIKey | LTQWQTNRIBKUMN-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)NS(=O)(=O)C)O.Cl |
Computed by PubChem (NCBI)