CAS 2878499-88-6 is the registry number for tert-Butyl 2-(chlorosulfonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chlorosulfonyl-2,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 2878499-88-6) is a chemical compound with the molecular formula C12H21ClN2O4S and a molecular weight of 324.82 g/mol. IUPAC name: tert-butyl 2-chlorosulfonyl-2,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: SAXGOGYTZVLSGH-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O4S |
|---|---|
| Molecular weight | 324.82 g/mol |
| IUPAC name | tert-butyl 2-chlorosulfonyl-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | SAXGOGYTZVLSGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)