CAS 1482-82-2 appears in our catalog under these names: Dibenzyl Diselenide, Dibenzyl diselenide, 95% , Dibenzyl Diselenide, >95.0%(T), Dibenzyl diselenide 95%, 1,2-Dibenzyldiselane, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 500g.
(benzyldiselanyl)methylbenzene (CAS 1482-82-2) is a chemical compound with the molecular formula C14H14Se2 and a molecular weight of 340.2 g/mol. IUPAC name: (benzyldiselanyl)methylbenzene. InChIKey: HYAVEDMFTNAZQE-UHFFFAOYSA-N.
| Molecular formula | C14H14Se2 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | (benzyldiselanyl)methylbenzene |
| InChIKey | HYAVEDMFTNAZQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[Se][Se]CC2=CC=CC=C2 |
Computed by PubChem (NCBI)