CAS 21856-94-0 is the registry number for 1,2-Di-p-tolyldiselane 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-methyl-4-[(4-methylphenyl)diselanyl]benzene (CAS 21856-94-0) is a chemical compound with the molecular formula C14H14Se2 and a molecular weight of 340.2 g/mol. IUPAC name: 1-methyl-4-[(4-methylphenyl)diselanyl]benzene. InChIKey: KJCNOACMRYZZFR-UHFFFAOYSA-N.
| Molecular formula | C14H14Se2 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 1-methyl-4-[(4-methylphenyl)diselanyl]benzene |
| InChIKey | KJCNOACMRYZZFR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)[Se][Se]C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)