Products 148206-99-9

CAS 148206-99-9 is the registry number for 2,2–Bis–Benzyloxymethyl–Malonic Acid Diethyl Ester. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2,2-bis(phenylmethoxymethyl)propanedioate (CAS 148206-99-9) is a chemical compound with the molecular formula C23H28O6 and a molecular weight of 400.5 g/mol. IUPAC name: diethyl 2,2-bis(phenylmethoxymethyl)propanedioate. InChIKey: DWTIQBRFUBHCSP-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28O6
Molecular weight400.5 g/mol
IUPAC namediethyl 2,2-bis(phenylmethoxymethyl)propanedioate
InChIKeyDWTIQBRFUBHCSP-UHFFFAOYSA-N
SMILESCCOC(=O)C(COCC1=CC=CC=C1)(COCC2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)