CAS 148209-54-5 appears in our catalog under these names: 1-(tert-Butyl)-3,5-diiodobenzene, 98%, 1-Tert-butyl-3,5-diiodobenzene, 98%, 98%, 1-(1,1-Dimethylethyl)-3,5-diiodobenzene, 98%, 1-(tert-Butyl)-3,5-diiodobenzene, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg, 10g.
1-tert-butyl-3,5-diiodobenzene (CAS 148209-54-5) is a chemical compound with the molecular formula C10H12I2 and a molecular weight of 386.01 g/mol. IUPAC name: 1-tert-butyl-3,5-diiodobenzene. InChIKey: QNWDPUVVJSFQSP-UHFFFAOYSA-N.
| Molecular formula | C10H12I2 |
|---|---|
| Molecular weight | 386.01 g/mol |
| IUPAC name | 1-tert-butyl-3,5-diiodobenzene |
| InChIKey | QNWDPUVVJSFQSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)I)I |
Computed by PubChem (NCBI)