CAS 3268-21-1 appears in our catalog under these names: 1,4–DIIODO–2,3,5,6–TETRAMETHYLBENZENE, 1,4-Diiodo-2,3,5,6-tetramethylbenzene, >95.0%(GC), 1,4-DIIODO-2,3,5,6-TETRAMETHYLBENZENE, 98%, 98%, 1,4-Diiodo-2,3,5,6-tetramethylbenzene, 98%, 1,4-Diiodo-2,3,5,6-tetramethylbenzene, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
1,4-diiodo-2,3,5,6-tetramethylbenzene (CAS 3268-21-1) is a chemical compound with the molecular formula C10H12I2 and a molecular weight of 386.01 g/mol. IUPAC name: 1,4-diiodo-2,3,5,6-tetramethylbenzene. InChIKey: YSKCEXICRGEWDI-UHFFFAOYSA-N.
| Molecular formula | C10H12I2 |
|---|---|
| Molecular weight | 386.01 g/mol |
| IUPAC name | 1,4-diiodo-2,3,5,6-tetramethylbenzene |
| InChIKey | YSKCEXICRGEWDI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1I)C)C)I)C |
Computed by PubChem (NCBI)