Products 1482156-51-3
CAS 1482156-51-3 is the registry number for 4-[(Cyclobutylmethyl)(methyl)carbamoyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[cyclobutylmethyl(methyl)carbamoyl]benzoic acid (CAS 1482156-51-3) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-[cyclobutylmethyl(methyl)carbamoyl]benzoic acid. InChIKey: GYTJAAYGZSEGKY-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-[cyclobutylmethyl(methyl)carbamoyl]benzoic acid |
| InChIKey | GYTJAAYGZSEGKY-UHFFFAOYSA-N |
| SMILES | CN(CC1CCC1)C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)