CAS 148231-14-5 is the registry number for 5,8–Dibromo–2,3–diethylquinoxaline. Offered by: GLPBio. Available pack sizes: 1g.
5,8-dibromo-2,3-diethylquinoxaline (CAS 148231-14-5) is a chemical compound with the molecular formula C12H12Br2N2 and a molecular weight of 344.04 g/mol. IUPAC name: 5,8-dibromo-2,3-diethylquinoxaline. InChIKey: SXPVFRWOXOCNCK-UHFFFAOYSA-N.
| Molecular formula | C12H12Br2N2 |
|---|---|
| Molecular weight | 344.04 g/mol |
| IUPAC name | 5,8-dibromo-2,3-diethylquinoxaline |
| InChIKey | SXPVFRWOXOCNCK-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C=CC(=C2N=C1CC)Br)Br |
Computed by PubChem (NCBI)