CAS 2379321-20-5 appears in our catalog under these names: 4-Bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethyl-1h-pyrazole, 95%, 4-Bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethyl-1H-pyrazole, ≥95%, ≥95%, 4-Bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethyl-1H-pyrazole, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole (CAS 2379321-20-5) is a chemical compound with the molecular formula C12H12Br2N2 and a molecular weight of 344.04 g/mol. IUPAC name: 4-bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole. InChIKey: OMAIHCHCUZMLCQ-UHFFFAOYSA-N.
| Molecular formula | C12H12Br2N2 |
|---|---|
| Molecular weight | 344.04 g/mol |
| IUPAC name | 4-bromo-1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole |
| InChIKey | OMAIHCHCUZMLCQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=C(C(=N2)C)Br)C)Br |
Computed by PubChem (NCBI)