CAS 148240-65-7 appears in our catalog under these names: (S,S)-1,2-bis(2-methoxyphenyl)-1,2-ethanediamine, 97%, 97%, (1S,2S)-1,2-Bis(2-methoxyphenyl)ethane-1,2-diamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S,2S)-1,2-bis(2-methoxyphenyl)ethane-1,2-diamine (CAS 148240-65-7) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: (1S,2S)-1,2-bis(2-methoxyphenyl)ethane-1,2-diamine. InChIKey: CTMKVJFFLNHDQE-HOTGVXAUSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(2-methoxyphenyl)ethane-1,2-diamine |
| InChIKey | CTMKVJFFLNHDQE-HOTGVXAUSA-N |
| SMILES | COC1=CC=CC=C1[C@@H]([C@H](C2=CC=CC=C2OC)N)N |
Computed by PubChem (NCBI)