CAS 146436-31-9 appears in our catalog under these names: 1-Isobutyl-2,3,4,9-tetrahydro-1h-pyrido[3,4-b]indole-3-carboxylic acid, 95%, 1–Isobutyl–2,3,4,9–tetrahydro–1H–pyrido(3,4–b)indole–3–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-(2-methylpropyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 146436-31-9) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: 1-(2-methylpropyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: MKRFXFYXNSJWRC-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-(2-methylpropyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | MKRFXFYXNSJWRC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1C2=C(CC(N1)C(=O)O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)