Products 1482714-93-1

CAS 1482714-93-1 is the registry number for 2-(4-Fluorophenyl)spiro[3.3]heptane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-fluorophenyl)spiro[3.3]heptane-2-carboxylic acid (CAS 1482714-93-1) is a chemical compound with the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. IUPAC name: 2-(4-fluorophenyl)spiro[3.3]heptane-2-carboxylic acid. InChIKey: FIISWXQEHKQDGD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15FO2
Molecular weight234.27 g/mol
IUPAC name2-(4-fluorophenyl)spiro[3.3]heptane-2-carboxylic acid
InChIKeyFIISWXQEHKQDGD-UHFFFAOYSA-N
SMILESC1CC2(C1)CC(C2)(C3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)