Products 2742656-74-0
CAS 2742656-74-0 is the registry number for 2-(2-Fluoro-3-phenylbicyclo[1.1.1]pentan-1-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-fluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)propanoic acid (CAS 2742656-74-0) is a chemical compound with the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. IUPAC name: 2-(2-fluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)propanoic acid. InChIKey: CQEAUMIULAAZCQ-UHFFFAOYSA-N.
| Molecular formula | C14H15FO2 |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 2-(2-fluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)propanoic acid |
| InChIKey | CQEAUMIULAAZCQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)C12CC(C1)(C2F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)