Products 148292-41-5

CAS 148292-41-5 is the registry number for Pyridinium, 2-methyl-1-pentyl-, bromide (1:1), 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-1-pentylpyridin-1-ium bromide (CAS 148292-41-5) is a chemical compound with the molecular formula C11H18BrN and a molecular weight of 244.17 g/mol. IUPAC name: 2-methyl-1-pentylpyridin-1-ium bromide. InChIKey: WUGXMQKRNVELEX-UHFFFAOYSA-M.

Identity
Molecular formulaC11H18BrN
Molecular weight244.17 g/mol
IUPAC name2-methyl-1-pentylpyridin-1-ium bromide
InChIKeyWUGXMQKRNVELEX-UHFFFAOYSA-M
SMILESCCCCC[N+]1=CC=CC=C1C.[Br-]

Computed by PubChem (NCBI)