CAS 663941-83-1 is the registry number for (4-(tert-Butyl)phenyl)methanamine hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-tert-butylphenyl)methanamine;hydrobromide (CAS 663941-83-1) is a chemical compound with the molecular formula C11H18BrN and a molecular weight of 244.17 g/mol. IUPAC name: (4-tert-butylphenyl)methanamine;hydrobromide. InChIKey: UCZUIIHQELMPJU-UHFFFAOYSA-N.
| Molecular formula | C11H18BrN |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | (4-tert-butylphenyl)methanamine;hydrobromide |
| InChIKey | UCZUIIHQELMPJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN.Br |
Computed by PubChem (NCBI)