Products 1483921-01-2

CAS 1483921-01-2 appears in our catalog under these names: 4-Bromo-5-carbamoyl-2-fluorobenzene-1-sulfonyl chloride, 95%, 4-Bromo-5-carbamoyl-2-fluorobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

4-bromo-5-carbamoyl-2-fluorobenzenesulfonyl chloride (CAS 1483921-01-2) is a chemical compound with the molecular formula C7H4BrClFNO3S and a molecular weight of 316.53 g/mol. IUPAC name: 4-bromo-5-carbamoyl-2-fluorobenzenesulfonyl chloride. InChIKey: KJLCLHNURHAFEP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClFNO3S
Molecular weight316.53 g/mol
IUPAC name4-bromo-5-carbamoyl-2-fluorobenzenesulfonyl chloride
InChIKeyKJLCLHNURHAFEP-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)F)Br)C(=O)N

Computed by PubChem (NCBI)