Products 1490768-70-1

CAS 1490768-70-1 appears in our catalog under these names: 2-Bromo-5-carbamoyl-4-fluorobenzene-1-sulfonyl chloride, 95%, 2-Bromo-5-carbamoyl-4-fluorobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-5-carbamoyl-4-fluorobenzenesulfonyl chloride (CAS 1490768-70-1) is a chemical compound with the molecular formula C7H4BrClFNO3S and a molecular weight of 316.53 g/mol. IUPAC name: 2-bromo-5-carbamoyl-4-fluorobenzenesulfonyl chloride. InChIKey: JRYITXBHZAKZDN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClFNO3S
Molecular weight316.53 g/mol
IUPAC name2-bromo-5-carbamoyl-4-fluorobenzenesulfonyl chloride
InChIKeyJRYITXBHZAKZDN-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)Br)F)C(=O)N

Computed by PubChem (NCBI)