CAS 148494-90-0 is the registry number for 1-Phenylpiperidin-3-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-phenylpiperidin-3-one (CAS 148494-90-0) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-phenylpiperidin-3-one. InChIKey: CBUHYYSHSILDSD-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-phenylpiperidin-3-one |
| InChIKey | CBUHYYSHSILDSD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)